C32H32N4O8 — CID 54694598
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-[(pyridin-3-ylmethylamino)methyl]furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54694598) has the molecular formula C32H32N4O8 and a molecular weight of 600.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-[(pyridin-3-ylmethylamino)methyl]furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-[(pyridin-3-ylmethylamino)methyl]furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54694598 |
| Molecular Formula | C32H32N4O8 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-[(pyridin-3-ylmethylamino)methyl]furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(CNCc6cccnc6)o5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C32H32N4O8/c1-36(2)26-20-11-16-10-19-18(22-8-5-17(44-22)14-35-13-15-4-3-9-34-12-15)6-7-21(37)24(19)27(38)23(16)29(40)32(20,43)30(41)25(28(26)39)31(33)42/h3-9,12,16,20,26,35,37-38,41,43H,10-11,13-14H2,1-2H3,(H2,33,42)/t16-,20-,26-,32-/m0/s1 |
| InChIKey | OLIKSHCZBJMQQC-YKGIFYAISA-N |
| XLogP | 1.91 |
| TPSA | 199.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|