C14H17N3O2S2 — CID 5469483
(5Z)-2-methylsulfanyl-3-(morpholin-4-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one (PubChem CID 5469483) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (5Z)-2-methylsulfanyl-3-(morpholin-4-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one.
| Compound Name | (5Z)-2-methylsulfanyl-3-(morpholin-4-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one |
|---|---|
| PubChem CID | 5469483 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (5Z)-2-methylsulfanyl-3-(morpholin-4-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one |
| SMILES | CSC1=N/C(=C\c2cccs2)C(=O)N1CN1CCOCC1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-20-14-15-12(9-11-3-2-8-21-11)13(18)17(14)10-16-4-6-19-7-5-16/h2-3,8-9H,4-7,10H2,1H3/b12-9- |
| InChIKey | GVSINYPEYJLMHI-XFXZXTDPSA-N |
| XLogP | 1.94 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|