C15H19N3OS2 — CID 5469489
(5Z)-2-methylsulfanyl-3-(piperidin-1-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one (PubChem CID 5469489) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (5Z)-2-methylsulfanyl-3-(piperidin-1-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one.
| Compound Name | (5Z)-2-methylsulfanyl-3-(piperidin-1-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one |
|---|---|
| PubChem CID | 5469489 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (5Z)-2-methylsulfanyl-3-(piperidin-1-ylmethyl)-5-(thiophen-2-ylmethylidene)imidazol-4-one |
| SMILES | CSC1=N/C(=C\c2cccs2)C(=O)N1CN1CCCCC1 |
| InChI | InChI=1S/C15H19N3OS2/c1-20-15-16-13(10-12-6-5-9-21-12)14(19)18(15)11-17-7-3-2-4-8-17/h5-6,9-10H,2-4,7-8,11H2,1H3/b13-10- |
| InChIKey | ZPGSTKDPLVBGHF-RAXLEYEMSA-N |
| XLogP | 3.09 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|