C14H14N2OS2 — CID 5470559
(5Z)-3-prop-2-enyl-2-prop-2-enylsulfanyl-5-(thiophen-2-ylmethylidene)imidazol-4-one (PubChem CID 5470559) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (5Z)-3-prop-2-enyl-2-prop-2-enylsulfanyl-5-(thiophen-2-ylmethylidene)imidazol-4-one.
| Compound Name | (5Z)-3-prop-2-enyl-2-prop-2-enylsulfanyl-5-(thiophen-2-ylmethylidene)imidazol-4-one |
|---|---|
| PubChem CID | 5470559 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (5Z)-3-prop-2-enyl-2-prop-2-enylsulfanyl-5-(thiophen-2-ylmethylidene)imidazol-4-one |
| SMILES | C=CCSC1=N/C(=C\c2cccs2)C(=O)N1CC=C |
| InChI | InChI=1S/C14H14N2OS2/c1-3-7-16-13(17)12(10-11-6-5-9-18-11)15-14(16)19-8-4-2/h3-6,9-10H,1-2,7-8H2/b12-10- |
| InChIKey | UULLAUGEEZHUHY-BENRWUELSA-N |
| XLogP | 3.39 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|