C19H18N2OS — CID 5469538
(1S,14S)-14-methyl-15-oxa-11-thia-2,13-diazapentacyclo[12.7.1.02,12.04,9.016,21]docosa-4,6,8,12,16,18,20-heptaene (PubChem CID 5469538) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is (1S,14S)-14-methyl-15-oxa-11-thia-2,13-diazapentacyclo[12.7.1.02,12.04,9.016,21]docosa-4,6,8,12,16,18,20-heptaene.
| Compound Name | (1S,14S)-14-methyl-15-oxa-11-thia-2,13-diazapentacyclo[12.7.1.02,12.04,9.016,21]docosa-4,6,8,12,16,18,20-heptaene |
|---|---|
| PubChem CID | 5469538 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (1S,14S)-14-methyl-15-oxa-11-thia-2,13-diazapentacyclo[12.7.1.02,12.04,9.016,21]docosa-4,6,8,12,16,18,20-heptaene |
| SMILES | C[C@@]12C[C@@H](c3ccccc3O1)N1Cc3ccccc3CSC1=N2 |
| InChI | InChI=1S/C19H18N2OS/c1-19-10-16(15-8-4-5-9-17(15)22-19)21-11-13-6-2-3-7-14(13)12-23-18(21)20-19/h2-9,16H,10-12H2,1H3/t16-,19-/m0/s1 |
| InChIKey | GOPKBGORRFGSNU-LPHOPBHVSA-N |
| XLogP | 4.34 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |