C13H11NO4 — CID 54696231
methyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate (PubChem CID 54696231) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate.
| Compound Name | methyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54696231 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | methyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(O)/C(=C/c2ccccc2)NC1=O |
| InChI | InChI=1S/C13H11NO4/c1-18-13(17)10-11(15)9(14-12(10)16)7-8-5-3-2-4-6-8/h2-7,15H,1H3,(H,14,16)/b9-7- |
| InChIKey | VSJBIVZJKVBMLX-CLFYSBASSA-N |
| XLogP | 1.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|