C17H24N3O4+ — CID 54697176
2-hydroxyethyl-[2-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]ethyl]azanium (PubChem CID 54697176) has the molecular formula C17H24N3O4+ and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-hydroxyethyl-[2-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]ethyl]azanium.
| Compound Name | 2-hydroxyethyl-[2-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 54697176 |
| Molecular Formula | C17H24N3O4+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-hydroxyethyl-[2-[(4-hydroxy-2-oxo-1-propylquinoline-3-carbonyl)amino]ethyl]azanium |
| SMILES | CCCn1c(=O)c(C(=O)NCC[NH2+]CCO)c(O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O4/c1-2-10-20-13-6-4-3-5-12(13)15(22)14(17(20)24)16(23)19-8-7-18-9-11-21/h3-6,18,21-22H,2,7-11H2,1H3,(H,19,23)/p+1 |
| InChIKey | VEIXOMYONFBGTG-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|