C9H4F3N2O5S- — CID 54699353
1-oxido-6-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid (PubChem CID 54699353) has the molecular formula C9H4F3N2O5S- and a molecular weight of 309.20 g/mol. Its IUPAC name is 1-oxido-6-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid.
| Compound Name | 1-oxido-6-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 54699353 |
| Molecular Formula | C9H4F3N2O5S- |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 1-oxido-6-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc2ccc(S(=O)(=O)C(F)(F)F)cc2n1[O-] |
| InChI | InChI=1S/C9H4F3N2O5S/c10-9(11,12)20(18,19)4-1-2-5-6(3-4)14(17)7(13-5)8(15)16/h1-3H,(H,15,16)/q-1 |
| InChIKey | FBHMPXATHPBMRJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|