C21H14FKNO5S2+ — CID 54704205
potassium 3-[5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)thiophen-2-yl]-4-hydroxypyrrole-2,5-dione (PubChem CID 54704205) has the molecular formula C21H14FKNO5S2+ and a molecular weight of 482.58 g/mol. Its IUPAC name is potassium 3-[5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)thiophen-2-yl]-4-hydroxypyrrole-2,5-dione.
| Compound Name | potassium 3-[5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)thiophen-2-yl]-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 54704205 |
| Molecular Formula | C21H14FKNO5S2+ |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | potassium 3-[5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)thiophen-2-yl]-4-hydroxypyrrole-2,5-dione |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(C3=C(O)C(=O)NC3=O)sc2-c2ccc(F)cc2)cc1.[K+] |
| InChI | InChI=1S/C21H14FNO5S2.K/c1-30(27,28)14-8-4-11(5-9-14)15-10-16(17-18(24)21(26)23-20(17)25)29-19(15)12-2-6-13(22)7-3-12;/h2-10H,1H3,(H2,23,24,25,26);/q;+1 |
| InChIKey | BEUHGQIHTARLRW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|