C23H28N2O2 — CID 5470473
N-(3-methylbutyl)-4-[[[(E)-2-methyl-3-phenylprop-2-enoyl]amino]methyl]benzamide (PubChem CID 5470473) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(3-methylbutyl)-4-[[[(E)-2-methyl-3-phenylprop-2-enoyl]amino]methyl]benzamide.
| Compound Name | N-(3-methylbutyl)-4-[[[(E)-2-methyl-3-phenylprop-2-enoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 5470473 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(3-methylbutyl)-4-[[[(E)-2-methyl-3-phenylprop-2-enoyl]amino]methyl]benzamide |
| SMILES | C/C(=C\c1ccccc1)C(=O)NCc1ccc(C(=O)NCCC(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-17(2)13-14-24-23(27)21-11-9-20(10-12-21)16-25-22(26)18(3)15-19-7-5-4-6-8-19/h4-12,15,17H,13-14,16H2,1-3H3,(H,24,27)(H,25,26)/b18-15+ |
| InChIKey | GFYSCQFSUNMNIC-OBGWFSINSA-N |
| XLogP | 4.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|