C20H17N2O5S- — CID 54707002
4-[(Z)-[2-(3-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate (PubChem CID 54707002) has the molecular formula C20H17N2O5S- and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-[(Z)-[2-(3-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate.
| Compound Name | 4-[(Z)-[2-(3-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate |
|---|---|
| PubChem CID | 54707002 |
| Molecular Formula | C20H17N2O5S- |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-[(Z)-[2-(3-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate |
| SMILES | CCN1C(=O)/C(=C/c2ccc([O-])c(OC)c2)S/C1=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H18N2O5S/c1-3-22-18(24)17(10-12-7-8-15(23)16(9-12)27-2)28-20(22)21-14-6-4-5-13(11-14)19(25)26/h4-11,23H,3H2,1-2H3,(H,25,26)/p-1/b17-10-,21-20+ |
| InChIKey | AXDFRKLZPUHKAN-KQHCDTJNSA-M |
| XLogP | 3.09 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|