C34H46N4O12 — CID 54707191
[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl-(2,2-dimethylpropyl)carbamoyl]oxymethyl 2-methoxyacetate (PubChem CID 54707191) has the molecular formula C34H46N4O12 and a molecular weight of 702.76 g/mol. Its IUPAC name is [[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl-(2,2-dimethylpropyl)carbamoyl]oxymethyl 2-methoxyacetate.
| Compound Name | [[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl-(2,2-dimethylpropyl)carbamoyl]oxymethyl 2-methoxyacetate |
|---|---|
| PubChem CID | 54707191 |
| Molecular Formula | C34H46N4O12 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | [[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl-(2,2-dimethylpropyl)carbamoyl]oxymethyl 2-methoxyacetate |
| SMILES | COCC(=O)OCOC(=O)N(Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3CC1C2)CC(C)(C)C |
| InChI | InChI=1S/C34H46N4O12/c1-33(2,3)14-38(32(46)50-15-49-21(39)13-48-8)12-17-11-20(36(4)5)18-9-16-10-19-25(37(6)7)28(42)24(31(35)45)30(44)34(19,47)29(43)22(16)27(41)23(18)26(17)40/h11,16,19,25,40-41,44,47H,9-10,12-15H2,1-8H3,(H2,35,45) |
| InChIKey | DUTPSKSJDUUZIS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 229.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|