C21H30O6 — CID 54707676
[(6Z,9Z,12Z)-pentadeca-6,9,12-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate (PubChem CID 54707676) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(6Z,9Z,12Z)-pentadeca-6,9,12-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate.
| Compound Name | [(6Z,9Z,12Z)-pentadeca-6,9,12-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate |
|---|---|
| PubChem CID | 54707676 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(6Z,9Z,12Z)-pentadeca-6,9,12-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCOC(=O)C1=C(O)[C@@H](CO)OC1=O |
| InChI | InChI=1S/C21H30O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-26-20(24)18-19(23)17(16-22)27-21(18)25/h3-4,6-7,9-10,17,22-23H,2,5,8,11-16H2,1H3/b4-3-,7-6-,10-9-/t17-/m1/s1 |
| InChIKey | MLCOAGANYGZERM-KITAFTRQSA-N |
| XLogP | 3.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|