C17H11N3O2S — CID 54707814
4-hydroxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one (PubChem CID 54707814) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 4-hydroxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54707814 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-hydroxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2c(O)c1-c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C17H11N3O2S/c21-15-11-3-1-2-4-12(11)19-16(22)14(15)13-9-23-17(20-13)10-5-7-18-8-6-10/h1-9H,(H2,19,21,22) |
| InChIKey | CVMAHPSTCONZBL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |