C31H31N3O12 — CID 54707950
3-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]phthalic acid (PubChem CID 54707950) has the molecular formula C31H31N3O12 and a molecular weight of 637.60 g/mol. Its IUPAC name is 3-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]phthalic acid.
| Compound Name | 3-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]phthalic acid |
|---|---|
| PubChem CID | 54707950 |
| Molecular Formula | C31H31N3O12 |
| Molecular Weight | 637.60 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | 3-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]phthalic acid |
| SMILES | CN(C)C1C(=O)C(C(=O)NCNc2cccc(C(=O)O)c2C(=O)O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3CC12 |
| InChI | InChI=1S/C31H31N3O12/c1-30(45)13-7-5-9-17(35)19(13)23(36)20-14(30)10-15-22(34(2)3)24(37)21(26(39)31(15,46)25(20)38)27(40)33-11-32-16-8-4-6-12(28(41)42)18(16)29(43)44/h4-9,14-15,22,32,35-36,39,45-46H,10-11H2,1-3H3,(H,33,40)(H,41,42)(H,43,44) |
| InChIKey | PCKLVBKHWFAPQC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 254.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|