C11H18O3 — CID 54708853
5-butan-2-yl-4-hydroxy-2,2-dimethyl-3H-pyran-6-one (PubChem CID 54708853) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 5-butan-2-yl-4-hydroxy-2,2-dimethyl-3H-pyran-6-one.
| Compound Name | 5-butan-2-yl-4-hydroxy-2,2-dimethyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 54708853 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 5-butan-2-yl-4-hydroxy-2,2-dimethyl-3H-pyran-6-one |
| SMILES | CCC(C)C1=C(O)CC(C)(C)OC1=O |
| InChI | InChI=1S/C11H18O3/c1-5-7(2)9-8(12)6-11(3,4)14-10(9)13/h7,12H,5-6H2,1-4H3 |
| InChIKey | AKOLDRWVUJNTPU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |