About 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one
2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one (PubChem CID 59928527) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one.
Analyze 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one?
The IUPAC name of 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one (CID 59928527) is 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one?
The canonical SMILES for 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one is CCC1OC(=O)C(C)=C(O)C1CC.
What is the InChIKey of 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one?
The InChIKey is CWBUOFCNDBVZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-4-7-8(5-2)13-10(12)6(3)9(7)11/h7-8,11H,4-5H2,1-3H3.
What are the key properties of 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one?
2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one has a molecular weight of 184.23 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethyl-4-hydroxy-5-methyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 59928527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).