C8H12O3 — CID 54713230
4-hydroxy-2-propan-2-yl-2,3-dihydropyran-6-one (PubChem CID 54713230) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-hydroxy-2-propan-2-yl-2,3-dihydropyran-6-one.
| Compound Name | 4-hydroxy-2-propan-2-yl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 54713230 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-hydroxy-2-propan-2-yl-2,3-dihydropyran-6-one |
| SMILES | CC(C)C1CC(O)=CC(=O)O1 |
| InChI | InChI=1S/C8H12O3/c1-5(2)7-3-6(9)4-8(10)11-7/h4-5,7,9H,3H2,1-2H3 |
| InChIKey | RTAUKOBQUYQBAB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |