C6H8O3 — CID 71764471
(2R)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one (PubChem CID 71764471) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2R)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 71764471 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (2R)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one |
| SMILES | C[C@@H]1CC(O)=CC(=O)O1 |
| InChI | InChI=1S/C6H8O3/c1-4-2-5(7)3-6(8)9-4/h3-4,7H,2H2,1H3/t4-/m1/s1 |
| InChIKey | PXNRZJNTMDCHFR-SCSAIBSYSA-N |
| XLogP | 0.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |