C8H10O4 — CID 54709934
3-acetyl-4-hydroxy-5,5-dimethylfuran-2-one (PubChem CID 54709934) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-5,5-dimethylfuran-2-one.
| Compound Name | 3-acetyl-4-hydroxy-5,5-dimethylfuran-2-one |
|---|---|
| PubChem CID | 54709934 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-acetyl-4-hydroxy-5,5-dimethylfuran-2-one |
| SMILES | CC(=O)C1=C(O)C(C)(C)OC1=O |
| InChI | InChI=1S/C8H10O4/c1-4(9)5-6(10)8(2,3)12-7(5)11/h10H,1-3H3 |
| InChIKey | QQUHSMIUJJKOLB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|