C28H24O6S — CID 54710562
methyl 2-[[3-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoate (PubChem CID 54710562) has the molecular formula C28H24O6S and a molecular weight of 488.56 g/mol. Its IUPAC name is methyl 2-[[3-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoate.
| Compound Name | methyl 2-[[3-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 54710562 |
| Molecular Formula | C28H24O6S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | methyl 2-[[3-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1COc1cccc(-c2cc(O)c(SCCc3ccccc3)c(=O)o2)c1 |
| InChI | InChI=1S/C28H24O6S/c1-32-27(30)23-13-6-5-10-21(23)18-33-22-12-7-11-20(16-22)25-17-24(29)26(28(31)34-25)35-15-14-19-8-3-2-4-9-19/h2-13,16-17,29H,14-15,18H2,1H3 |
| InChIKey | HPGRREPVHVXWSO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |