C27H22O6S — CID 54737104
4-[[2-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoic acid (PubChem CID 54737104) has the molecular formula C27H22O6S and a molecular weight of 474.53 g/mol. Its IUPAC name is 4-[[2-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 54737104 |
| Molecular Formula | C27H22O6S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 4-[[2-[4-hydroxy-6-oxo-5-(2-phenylethylsulfanyl)pyran-2-yl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccccc2-c2cc(O)c(SCCc3ccccc3)c(=O)o2)cc1 |
| InChI | InChI=1S/C27H22O6S/c28-22-16-24(33-27(31)25(22)34-15-14-18-6-2-1-3-7-18)21-8-4-5-9-23(21)32-17-19-10-12-20(13-11-19)26(29)30/h1-13,16,28H,14-15,17H2,(H,29,30) |
| InChIKey | LKLWYRQYDSCGAV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |