C21H20O6S — CID 54681268
3-benzylsulfanyl-4-hydroxy-6-(2,3,4-trimethoxyphenyl)pyran-2-one (PubChem CID 54681268) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-hydroxy-6-(2,3,4-trimethoxyphenyl)pyran-2-one.
| Compound Name | 3-benzylsulfanyl-4-hydroxy-6-(2,3,4-trimethoxyphenyl)pyran-2-one |
|---|---|
| PubChem CID | 54681268 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 3-benzylsulfanyl-4-hydroxy-6-(2,3,4-trimethoxyphenyl)pyran-2-one |
| SMILES | COc1ccc(-c2cc(O)c(SCc3ccccc3)c(=O)o2)c(OC)c1OC |
| InChI | InChI=1S/C21H20O6S/c1-24-16-10-9-14(18(25-2)19(16)26-3)17-11-15(22)20(21(23)27-17)28-12-13-7-5-4-6-8-13/h4-11,22H,12H2,1-3H3 |
| InChIKey | BQSOMHCKQDTQDY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |