C22H23ClN2O8 — CID 54711174
(4S,8aS)-6-(7-chloro-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl)-4-(dimethylamino)-1,8,8a-trihydroxy-3-oxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide (PubChem CID 54711174) has the molecular formula C22H23ClN2O8 and a molecular weight of 478.89 g/mol. Its IUPAC name is (4S,8aS)-6-(7-chloro-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl)-4-(dimethylamino)-1,8,8a-trihydroxy-3-oxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide.
| Compound Name | (4S,8aS)-6-(7-chloro-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl)-4-(dimethylamino)-1,8,8a-trihydroxy-3-oxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 54711174 |
| Molecular Formula | C22H23ClN2O8 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (4S,8aS)-6-(7-chloro-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl)-4-(dimethylamino)-1,8,8a-trihydroxy-3-oxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(O)=CC(C3(C)OC(=O)c4c(O)ccc(Cl)c43)CC12 |
| InChI | InChI=1S/C22H23ClN2O8/c1-21(15-10(23)4-5-11(26)13(15)20(31)33-21)8-6-9-16(25(2)3)17(28)14(19(24)30)18(29)22(9,32)12(27)7-8/h4-5,7-9,16,26-27,29,32H,6H2,1-3H3,(H2,24,30)/t8?,9?,16-,21?,22-/m0/s1 |
| InChIKey | CBVZEKZXDCHUTO-FOLZCNIDSA-N |
| XLogP | 1.05 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|