C22H24ClN2O11P — CID 135923389
(4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;phosphenic acid (PubChem CID 135923389) has the molecular formula C22H24ClN2O11P and a molecular weight of 558.86 g/mol. Its IUPAC name is (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;phosphenic acid.
| Compound Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;phosphenic acid |
|---|---|
| PubChem CID | 135923389 |
| Molecular Formula | C22H24ClN2O11P |
| Molecular Weight | 558.86 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;phosphenic acid |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(Cl)c4[C@@](C)(O)[C@H]3C[C@@H]12.O=[P+]([O-])O |
| InChI | InChI=1S/C22H23ClN2O8.HO3P/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21;1-4(2)3/h4-5,7-8,15,26-27,30,32-33H,6H2,1-3H3,(H2,24,31);(H,1,2,3)/t7-,8-,15-,21-,22-;/m0./s1 |
| InChIKey | HMBWPFHNDJSPRK-MRFRVZCGSA-N |
| XLogP | -0.72 |
| TPSA | 241.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.86 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|