C23H26ClN2O8+ — CID 170529218
[(4aR)-3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl]-trimethylazanium (PubChem CID 170529218) has the molecular formula C23H26ClN2O8+ and a molecular weight of 493.92 g/mol. Its IUPAC name is [(4aR)-3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl]-trimethylazanium.
| Compound Name | [(4aR)-3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl]-trimethylazanium |
|---|---|
| PubChem CID | 170529218 |
| Molecular Formula | C23H26ClN2O8+ |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [(4aR)-3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl]-trimethylazanium |
| SMILES | CC1(O)c2c(Cl)ccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C([N+](C)(C)C)C3CC21 |
| InChI | InChI=1S/C23H25ClN2O8/c1-22(33)8-7-9-16(26(2,3)4)18(29)14(21(25)32)20(31)23(9,34)19(30)12(8)17(28)13-11(27)6-5-10(24)15(13)22/h5-6,8-9,16,33-34H,7H2,1-4H3,(H4-,25,27,28,29,30,31,32)/p+1/t8?,9?,16?,22?,23-/m0/s1 |
| InChIKey | QXSVKNAPJWQBDN-YHBGDMLJSA-O |
| XLogP | 0.43 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|