C21H23ClN2O8 — CID 138911165
(3S,4aS,5S)-6-chloro-3-(dimethylamino)-1,5,9,10,11a-pentahydroxy-5-methyl-2,11-dioxo-3,3a,4,4a-tetrahydrocyclopenta[b]anthracene-1-carboxamide (PubChem CID 138911165) has the molecular formula C21H23ClN2O8 and a molecular weight of 466.87 g/mol. Its IUPAC name is (3S,4aS,5S)-6-chloro-3-(dimethylamino)-1,5,9,10,11a-pentahydroxy-5-methyl-2,11-dioxo-3,3a,4,4a-tetrahydrocyclopenta[b]anthracene-1-carboxamide.
| Compound Name | (3S,4aS,5S)-6-chloro-3-(dimethylamino)-1,5,9,10,11a-pentahydroxy-5-methyl-2,11-dioxo-3,3a,4,4a-tetrahydrocyclopenta[b]anthracene-1-carboxamide |
|---|---|
| PubChem CID | 138911165 |
| Molecular Formula | C21H23ClN2O8 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (3S,4aS,5S)-6-chloro-3-(dimethylamino)-1,5,9,10,11a-pentahydroxy-5-methyl-2,11-dioxo-3,3a,4,4a-tetrahydrocyclopenta[b]anthracene-1-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(O)(C(N)=O)C2(O)C(=O)C3=C(O)c4c(O)ccc(Cl)c4[C@@](C)(O)[C@H]3CC12 |
| InChI | InChI=1S/C21H23ClN2O8/c1-19(30)7-6-8-14(24(2)3)17(28)21(32,18(23)29)20(8,31)16(27)11(7)15(26)12-10(25)5-4-9(22)13(12)19/h4-5,7-8,14,25-26,30-32H,6H2,1-3H3,(H2,23,29)/t7-,8?,14-,19-,20?,21?/m0/s1 |
| InChIKey | QRNKJWHRZHFTSK-VSSGKYIQSA-N |
| XLogP | -0.80 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|