C22H24Cl2N2O8 — CID 54721451
(3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl)-dimethylazanium chloride (PubChem CID 54721451) has the molecular formula C22H24Cl2N2O8 and a molecular weight of 515.35 g/mol. Its IUPAC name is (3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl)-dimethylazanium chloride.
| Compound Name | (3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 54721451 |
| Molecular Formula | C22H24Cl2N2O8 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | (3-carbamoyl-10-chloro-4,4a,6,7,11-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-1-yl)-dimethylazanium chloride |
| SMILES | C[NH+](C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(Cl)c4C(C)(O)C3CC12.[Cl-] |
| InChI | InChI=1S/C22H23ClN2O8.ClH/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21;/h4-5,7-8,15,26-27,30,32-33H,6H2,1-3H3,(H2,24,31);1H |
| InChIKey | QYAPHLRPFNSDNH-UHFFFAOYSA-N |
| XLogP | -4.13 |
| TPSA | 182.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|