C18H15ClN2O7S — CID 54693654
7-amino-4-chloro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydrobenzo[b]thioxanthene-9-carboxamide (PubChem CID 54693654) has the molecular formula C18H15ClN2O7S and a molecular weight of 438.85 g/mol. Its IUPAC name is 7-amino-4-chloro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydrobenzo[b]thioxanthene-9-carboxamide.
| Compound Name | 7-amino-4-chloro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydrobenzo[b]thioxanthene-9-carboxamide |
|---|---|
| PubChem CID | 54693654 |
| Molecular Formula | C18H15ClN2O7S |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 7-amino-4-chloro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydrobenzo[b]thioxanthene-9-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(Cl)c4SC3CC2C(N)C1=O |
| InChI | InChI=1S/C18H15ClN2O7S/c19-5-1-2-6(22)8-12(23)9-7(29-14(5)8)3-4-11(20)13(24)10(17(21)27)16(26)18(4,28)15(9)25/h1-2,4,7,11,22-23,26,28H,3,20H2,(H2,21,27) |
| InChIKey | ISVLHZFEXISMGE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|