C22H19N3O8 — CID 177229069
(4R,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229069) has the molecular formula C22H19N3O8 and a molecular weight of 453.41 g/mol. Its IUPAC name is (4R,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229069 |
| Molecular Formula | C22H19N3O8 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (4R,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cnoc5)c4C[C@H]3CC2[C@@H](N)C1=O |
| InChI | InChI=1S/C22H19N3O8/c23-16-11-4-7-3-10-9(8-5-25-33-6-8)1-2-12(26)14(10)17(27)13(7)19(29)22(11,32)20(30)15(18(16)28)21(24)31/h1-2,5-7,11,16,26-27,30,32H,3-4,23H2,(H2,24,31)/t7-,11?,16+,22-/m0/s1 |
| InChIKey | KVDKJRUKRPWMPR-ANLIISKHSA-N |
| XLogP | 0.02 |
| TPSA | 210.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|