C26H25N3O9 — CID 177229562
1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229562) has the molecular formula C26H25N3O9 and a molecular weight of 523.50 g/mol. Its IUPAC name is 1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229562 |
| Molecular Formula | C26H25N3O9 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-7-(1,2-oxazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cnoc5)c4CC3CC2C(N2CCOCC2)C1=O |
| InChI | InChI=1S/C26H25N3O9/c27-25(35)19-22(32)20(29-3-5-37-6-4-29)15-8-11-7-14-13(12-9-28-38-10-12)1-2-16(30)18(14)21(31)17(11)23(33)26(15,36)24(19)34/h1-2,9-11,15,20,30-31,34,36H,3-8H2,(H2,27,35) |
| InChIKey | PYXJDSLSADZERO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 196.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|