C24H26N2O7 — CID 177229435
(4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229435) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229435 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4C[C@H]3C[C@H]2[C@@H](N2CCCCC2)C1=O |
| InChI | InChI=1S/C24H26N2O7/c25-23(32)17-20(29)18(26-7-2-1-3-8-26)13-10-12-9-11-5-4-6-14(27)15(11)19(28)16(12)21(30)24(13,33)22(17)31/h4-6,12-13,18,27-28,31,33H,1-3,7-10H2,(H2,25,32)/t12-,13-,18+,24-/m0/s1 |
| InChIKey | SRUSFMPUIMYPEW-MQMYDBLTSA-N |
| XLogP | 0.89 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|