C28H33N3O9 — CID 177229432
tert-butyl 4-(3-carbamoyl-4,4a,6,7-tetrahydroxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl)piperazine-1-carboxylate (PubChem CID 177229432) has the molecular formula C28H33N3O9 and a molecular weight of 555.58 g/mol. Its IUPAC name is tert-butyl 4-(3-carbamoyl-4,4a,6,7-tetrahydroxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-carbamoyl-4,4a,6,7-tetrahydroxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177229432 |
| Molecular Formula | C28H33N3O9 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | tert-butyl 4-(3-carbamoyl-4,4a,6,7-tetrahydroxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C4=C(O)c5c(O)cccc5CC4CC23)CC1 |
| InChI | InChI=1S/C28H33N3O9/c1-27(2,3)40-26(38)31-9-7-30(8-10-31)20-15-12-14-11-13-5-4-6-16(32)17(13)21(33)18(14)23(35)28(15,39)24(36)19(22(20)34)25(29)37/h4-6,14-15,20,32-33,36,39H,7-12H2,1-3H3,(H2,29,37) |
| InChIKey | KEFHXUUFQNISQH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|