C26H29N3O8 — CID 177229020
(4R,5aR,12aR)-7-(azetidin-1-yl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229020) has the molecular formula C26H29N3O8 and a molecular weight of 511.53 g/mol. Its IUPAC name is (4R,5aR,12aR)-7-(azetidin-1-yl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,5aR,12aR)-7-(azetidin-1-yl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229020 |
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (4R,5aR,12aR)-7-(azetidin-1-yl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(N5CCC5)c4C[C@H]3CC2[C@@H](N2CCOCC2)C1=O |
| InChI | InChI=1S/C26H29N3O8/c27-25(35)19-22(32)20(29-6-8-37-9-7-29)14-11-12-10-13-15(28-4-1-5-28)2-3-16(30)18(13)21(31)17(12)23(33)26(14,36)24(19)34/h2-3,12,14,20,30-31,34,36H,1,4-11H2,(H2,27,35)/t12-,14?,20+,26-/m0/s1 |
| InChIKey | GXIUEZASTHPPKP-AICGBMMZSA-N |
| XLogP | -0.06 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|