C29H34N2O8 — CID 177229047
(4R,4aS,12aR)-7-(3,3-dimethylcyclobutyl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229047) has the molecular formula C29H34N2O8 and a molecular weight of 538.60 g/mol. Its IUPAC name is (4R,4aS,12aR)-7-(3,3-dimethylcyclobutyl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,12aR)-7-(3,3-dimethylcyclobutyl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229047 |
| Molecular Formula | C29H34N2O8 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (4R,4aS,12aR)-7-(3,3-dimethylcyclobutyl)-1,10,11,12a-tetrahydroxy-4-morpholin-4-yl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1(C)CC(c2ccc(O)c3c2CC2C[C@H]4[C@@H](N5CCOCC5)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)C1 |
| InChI | InChI=1S/C29H34N2O8/c1-28(2)11-14(12-28)15-3-4-18(32)20-16(15)9-13-10-17-22(31-5-7-39-8-6-31)24(34)21(27(30)37)26(36)29(17,38)25(35)19(13)23(20)33/h3-4,13-14,17,22,32-33,36,38H,5-12H2,1-2H3,(H2,30,37)/t13?,17-,22+,29-/m0/s1 |
| InChIKey | LPCSYKHVQUXWBN-BRJKLFTESA-N |
| XLogP | 1.64 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|