C27H31N3O7 — CID 177229394
(4R,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperazin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229394) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is (4R,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperazin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperazin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229394 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (4R,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-piperazin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C5CCC5)c4CC3CC2[C@@H](N2CCNCC2)C1=O |
| InChI | InChI=1S/C27H31N3O7/c28-26(36)20-23(33)21(30-8-6-29-7-9-30)16-11-13-10-15-14(12-2-1-3-12)4-5-17(31)19(15)22(32)18(13)24(34)27(16,37)25(20)35/h4-5,12-13,16,21,29,31-32,35,37H,1-3,6-11H2,(H2,28,36)/t13?,16?,21-,27+/m1/s1 |
| InChIKey | XJPKIEDRKXRWQP-CPWXRBGBSA-N |
| XLogP | 0.58 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|