C25H27N3O8 — CID 177229333
(4R,4aS,5aR,12aR)-4-(4-acetylpiperazin-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229333) has the molecular formula C25H27N3O8 and a molecular weight of 497.50 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-(4-acetylpiperazin-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-(4-acetylpiperazin-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229333 |
| Molecular Formula | C25H27N3O8 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-(4-acetylpiperazin-1-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)N1CCN([C@H]2C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C4=C(O)c5c(O)cccc5C[C@H]4C[C@@H]23)CC1 |
| InChI | InChI=1S/C25H27N3O8/c1-11(29)27-5-7-28(8-6-27)19-14-10-13-9-12-3-2-4-15(30)16(12)20(31)17(13)22(33)25(14,36)23(34)18(21(19)32)24(26)35/h2-4,13-14,19,30-31,34,36H,5-10H2,1H3,(H2,26,35)/t13-,14-,19+,25-/m0/s1 |
| InChIKey | XZBQVQGKUDZNPT-FEQXVNCYSA-N |
| XLogP | -0.43 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|