C28H34N2O8 — CID 177229114
(4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-[(2,2,6,6-tetramethyloxan-4-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229114) has the molecular formula C28H34N2O8 and a molecular weight of 526.59 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-[(2,2,6,6-tetramethyloxan-4-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-[(2,2,6,6-tetramethyloxan-4-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229114 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-[(2,2,6,6-tetramethyloxan-4-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1(C)CC(N[C@H]2C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C4=C(O)c5c(O)cccc5C[C@H]4C[C@@H]23)CC(C)(C)O1 |
| InChI | InChI=1S/C28H34N2O8/c1-26(2)10-14(11-27(3,4)38-26)30-20-15-9-13-8-12-6-5-7-16(31)17(12)21(32)18(13)23(34)28(15,37)24(35)19(22(20)33)25(29)36/h5-7,13-15,20,30-32,35,37H,8-11H2,1-4H3,(H2,29,36)/t13-,15-,20+,28-/m0/s1 |
| InChIKey | NNEBKRSJKXFZAV-VVYOHOQKSA-N |
| XLogP | 1.73 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|