C24H25BrN2O8 — CID 177229572
(4R,4aS,5aR,12aR)-4-[[3-(bromomethyl)oxetan-3-yl]methylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229572) has the molecular formula C24H25BrN2O8 and a molecular weight of 549.37 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-[[3-(bromomethyl)oxetan-3-yl]methylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-[[3-(bromomethyl)oxetan-3-yl]methylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229572 |
| Molecular Formula | C24H25BrN2O8 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-[[3-(bromomethyl)oxetan-3-yl]methylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4C[C@H]3C[C@H]2[C@@H](NCC2(CBr)COC2)C1=O |
| InChI | InChI=1S/C24H25BrN2O8/c25-6-23(8-35-9-23)7-27-17-12-5-11-4-10-2-1-3-13(28)14(10)18(29)15(11)20(31)24(12,34)21(32)16(19(17)30)22(26)33/h1-3,11-12,17,27-29,32,34H,4-9H2,(H2,26,33)/t11-,12-,17+,24-/m0/s1 |
| InChIKey | JOKOKWXZGWGHPM-XLESHAPLSA-N |
| XLogP | 0.40 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|