C23H23N5O7 — CID 177229604
(4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-[(1-methyltriazol-4-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229604) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-[(1-methyltriazol-4-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-[(1-methyltriazol-4-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229604 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-[(1-methyltriazol-4-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cn1cc(CN[C@H]2C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C4=C(O)c5c(O)cccc5C[C@H]4C[C@@H]23)nn1 |
| InChI | InChI=1S/C23H23N5O7/c1-28-8-11(26-27-28)7-25-17-12-6-10-5-9-3-2-4-13(29)14(9)18(30)15(10)20(32)23(12,35)21(33)16(19(17)31)22(24)34/h2-4,8,10,12,17,25,29-30,33,35H,5-7H2,1H3,(H2,24,34)/t10-,12-,17+,23-/m0/s1 |
| InChIKey | HZMYLSINQBPADE-MKMHVANWSA-N |
| XLogP | -0.68 |
| TPSA | 200.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|