C28H31N3O8 — CID 177229081
(4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229081) has the molecular formula C28H31N3O8 and a molecular weight of 537.57 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229081 |
| Molecular Formula | C28H31N3O8 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | (4R,4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(N5CCCC5)c4C[C@H]3C[C@H]2[C@@H](N2CC3(COC3)C2)C1=O |
| InChI | InChI=1S/C28H31N3O8/c29-26(37)20-23(34)21(31-9-27(10-31)11-39-12-27)15-8-13-7-14-16(30-5-1-2-6-30)3-4-17(32)19(14)22(33)18(13)24(35)28(15,38)25(20)36/h3-4,13,15,21,32-33,36,38H,1-2,5-12H2,(H2,29,37)/t13-,15-,21+,28-/m0/s1 |
| InChIKey | WQTDCGPLFNWPNB-BLVNXVQPSA-N |
| XLogP | 0.33 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|