C21H24ClN2O12P — CID 155423623
(4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;phosphoric acid (PubChem CID 155423623) has the molecular formula C21H24ClN2O12P and a molecular weight of 562.85 g/mol. Its IUPAC name is (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;phosphoric acid.
| Compound Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;phosphoric acid |
|---|---|
| PubChem CID | 155423623 |
| Molecular Formula | C21H24ClN2O12P |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;phosphoric acid |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(Cl)c4[C@@H](O)[C@H]3C[C@@H]12.O=P(O)(O)O |
| InChI | InChI=1S/C21H21ClN2O8.H3O4P/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31;1-5(2,3)4/h3-4,6-7,14-15,25-27,30,32H,5H2,1-2H3,(H2,23,31);(H3,1,2,3,4)/t6-,7-,14-,15-,21-;/m0./s1 |
| InChIKey | VBPRAYMZFRQITC-KBHRXELFSA-N |
| XLogP | -0.82 |
| TPSA | 259.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|