C14H22N3O3+ — CID 54711894
ethyl-[2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl]azanium (PubChem CID 54711894) has the molecular formula C14H22N3O3+ and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl-[2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl]azanium.
| Compound Name | ethyl-[2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 54711894 |
| Molecular Formula | C14H22N3O3+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl-[2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl]azanium |
| SMILES | CC[NH2+]CCNC(=O)c1c(O)c2c([nH]c1=O)CCCC2 |
| InChI | InChI=1S/C14H21N3O3/c1-2-15-7-8-16-13(19)11-12(18)9-5-3-4-6-10(9)17-14(11)20/h15H,2-8H2,1H3,(H,16,19)(H2,17,18,20)/p+1 |
| InChIKey | NVXJSLFNYOPVPX-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|