C20H34N3O3+ — CID 54712098
diethyl-[(4S)-4-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]pentyl]-methylazanium (PubChem CID 54712098) has the molecular formula C20H34N3O3+ and a molecular weight of 364.51 g/mol. Its IUPAC name is diethyl-[(4S)-4-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]pentyl]-methylazanium.
| Compound Name | diethyl-[(4S)-4-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]pentyl]-methylazanium |
|---|---|
| PubChem CID | 54712098 |
| Molecular Formula | C20H34N3O3+ |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | diethyl-[(4S)-4-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]pentyl]-methylazanium |
| SMILES | CC[N+](C)(CC)CCC[C@H](C)NC(=O)c1c(O)c2c([nH]c1=O)CCCC2 |
| InChI | InChI=1S/C20H33N3O3/c1-5-23(4,6-2)13-9-10-14(3)21-19(25)17-18(24)15-11-7-8-12-16(15)22-20(17)26/h14H,5-13H2,1-4H3,(H2-,21,22,24,25,26)/p+1/t14-/m0/s1 |
| InChIKey | CMQDOTQXWRFUNB-AWEZNQCLSA-O |
| XLogP | 2.34 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|