C13H13NO4S — CID 54712816
3-(benzenesulfonyl)-4-hydroxy-1,6-dimethylpyridin-2-one (PubChem CID 54712816) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-hydroxy-1,6-dimethylpyridin-2-one.
| Compound Name | 3-(benzenesulfonyl)-4-hydroxy-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 54712816 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-(benzenesulfonyl)-4-hydroxy-1,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(O)c(S(=O)(=O)c2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C13H13NO4S/c1-9-8-11(15)12(13(16)14(9)2)19(17,18)10-6-4-3-5-7-10/h3-8,15H,1-2H3 |
| InChIKey | KIVOHGYFDJXGLB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |