C12H14Br2O4 — CID 5471322
diethyl (2E,4E,6E)-4,5-dibromoocta-2,4,6-trienedioate (PubChem CID 5471322) has the molecular formula C12H14Br2O4 and a molecular weight of 382.05 g/mol. Its IUPAC name is diethyl (2E,4E,6E)-4,5-dibromoocta-2,4,6-trienedioate.
| Compound Name | diethyl (2E,4E,6E)-4,5-dibromoocta-2,4,6-trienedioate |
|---|---|
| PubChem CID | 5471322 |
| Molecular Formula | C12H14Br2O4 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | diethyl (2E,4E,6E)-4,5-dibromoocta-2,4,6-trienedioate |
| SMILES | CCOC(=O)/C=C/C(Br)=C(Br)/C=C/C(=O)OCC |
| InChI | InChI=1S/C12H14Br2O4/c1-3-17-11(15)7-5-9(13)10(14)6-8-12(16)18-4-2/h5-8H,3-4H2,1-2H3/b7-5+,8-6+,10-9+ |
| InChIKey | JEAIMWLUSUWICZ-BISOHRNISA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|