C19H19NO8 — CID 54713492
trimethyl 1-benzyl-6-hydroxy-7-oxo-2H-azepine-3,4,5-tricarboxylate (PubChem CID 54713492) has the molecular formula C19H19NO8 and a molecular weight of 389.36 g/mol. Its IUPAC name is trimethyl 1-benzyl-6-hydroxy-7-oxo-2H-azepine-3,4,5-tricarboxylate.
| Compound Name | trimethyl 1-benzyl-6-hydroxy-7-oxo-2H-azepine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 54713492 |
| Molecular Formula | C19H19NO8 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | trimethyl 1-benzyl-6-hydroxy-7-oxo-2H-azepine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)=C(O)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H19NO8/c1-26-17(23)12-10-20(9-11-7-5-4-6-8-11)16(22)15(21)14(19(25)28-3)13(12)18(24)27-2/h4-8,21H,9-10H2,1-3H3 |
| InChIKey | ZFWKUDLSDSORTG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|