C14H10N4O6 — CID 54714326
(Z)-2-cyano-N-(2,5-dioxopyrrolidin-1-yl)-3-hydroxy-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 54714326) has the molecular formula C14H10N4O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dioxopyrrolidin-1-yl)-3-hydroxy-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dioxopyrrolidin-1-yl)-3-hydroxy-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54714326 |
| Molecular Formula | C14H10N4O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dioxopyrrolidin-1-yl)-3-hydroxy-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(C(=O)NN1C(=O)CCC1=O)=C(/O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10N4O6/c15-7-10(14(22)16-17-11(19)5-6-12(17)20)13(21)8-1-3-9(4-2-8)18(23)24/h1-4,21H,5-6H2,(H,16,22)/b13-10- |
| InChIKey | BKZTZPHPVCLKFM-RAXLEYEMSA-N |
| XLogP | 0.57 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|