About 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide
1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide (PubChem CID 13204300) has the molecular formula C17H13N3O5
and a molecular weight of 339.31 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide.
Molecular Properties
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide |
| PubChem CID | 13204300 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide |
| SMILES | O=C1CCC(=O)N1/C(c1ccc([N+](=O)[O-])cc1)=[N+](\[O-])c1ccccc1 |
| InChI | InChI=1S/C17H13N3O5/c21-15-10-11-16(22)18(15)17(19(23)13-4-2-1-3-5-13)12-6-8-14(9-7-12)20(24)25/h1-9H,10-11H2/b19-17- |
| InChIKey | FQIPFTKTHSTWDS-ZPHPHTNESA-N |
| XLogP | 2.33 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide?
The IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide (CID 13204300) is 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide.
What is the SMILES notation for 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide?
The canonical SMILES for 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide is O=C1CCC(=O)N1/C(c1ccc([N+](=O)[O-])cc1)=[N+](\[O-])c1ccccc1.
What is the InChIKey of 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide?
The InChIKey is FQIPFTKTHSTWDS-ZPHPHTNESA-N. The full InChI is InChI=1S/C17H13N3O5/c21-15-10-11-16(22)18(15)17(19(23)13-4-2-1-3-5-13)12-6-8-14(9-7-12)20(24)25/h1-9H,10-11H2/b19-17-.
What are the key properties of 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide?
1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide has a molecular weight of 339.31 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dioxopyrrolidin-1-yl)-1-(4-nitrophenyl)-N-phenylmethanimine oxide is sourced from PubChem (CID 13204300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).