C21H19N2O6- — CID 54715393
2-carboxy-4-[[(5R)-5-ethoxycarbonyl-5-methyl-2-oxo-1-phenylpyrrol-3-yl]amino]phenolate (PubChem CID 54715393) has the molecular formula C21H19N2O6- and a molecular weight of 395.39 g/mol. Its IUPAC name is 2-carboxy-4-[[(5R)-5-ethoxycarbonyl-5-methyl-2-oxo-1-phenylpyrrol-3-yl]amino]phenolate.
| Compound Name | 2-carboxy-4-[[(5R)-5-ethoxycarbonyl-5-methyl-2-oxo-1-phenylpyrrol-3-yl]amino]phenolate |
|---|---|
| PubChem CID | 54715393 |
| Molecular Formula | C21H19N2O6- |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-carboxy-4-[[(5R)-5-ethoxycarbonyl-5-methyl-2-oxo-1-phenylpyrrol-3-yl]amino]phenolate |
| SMILES | CCOC(=O)[C@@]1(C)C=C(Nc2ccc([O-])c(C(=O)O)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H20N2O6/c1-3-29-20(28)21(2)12-16(18(25)23(21)14-7-5-4-6-8-14)22-13-9-10-17(24)15(11-13)19(26)27/h4-12,22,24H,3H2,1-2H3,(H,26,27)/p-1/t21-/m1/s1 |
| InChIKey | WMOMGLBWBZGINA-OAQYLSRUSA-M |
| XLogP | 2.12 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |